EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N7O2S |
| Net Charge | 0 |
| Average Mass | 371.426 |
| Monoisotopic Mass | 371.11644 |
| SMILES | CCS(=O)(=O)N1CC(CC#N)(n2cc(-c3ncnc4nccc34)cn2)C1 |
| InChI | InChI=1S/C16H17N7O2S/c1-2-26(24,25)22-9-16(10-22,4-5-17)23-8-12(7-21-23)14-13-3-6-18-15(13)20-11-19-14/h3,6-8,11H,2,4,9-10H2,1H3,(H,18,19,20) |
| InChIKey | XUZMWHLSFXCVMG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antirheumatic drug A drug used to treat rheumatoid arthritis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baricitinib (CHEBI:95341) has role anti-inflammatory agent (CHEBI:67079) |
| baricitinib (CHEBI:95341) has role antirheumatic drug (CHEBI:35842) |
| baricitinib (CHEBI:95341) has role antiviral agent (CHEBI:22587) |
| baricitinib (CHEBI:95341) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| baricitinib (CHEBI:95341) has role immunosuppressive agent (CHEBI:35705) |
| baricitinib (CHEBI:95341) is a azetidines (CHEBI:38777) |
| baricitinib (CHEBI:95341) is a nitrile (CHEBI:18379) |
| baricitinib (CHEBI:95341) is a pyrazoles (CHEBI:26410) |
| baricitinib (CHEBI:95341) is a pyrrolopyrimidine (CHEBI:38670) |
| baricitinib (CHEBI:95341) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| {1-(ethylsulfonyl)-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl]azetidin-3-yl}acetonitrile |
| INNs | Source |
|---|---|
| baricitinib | WHO MedNet |
| baricitinib | WHO MedNet |
| baricitinib | WHO MedNet |
| baricitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(ethylsulfonyl)-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl]-3-azetidineacetonitrile | ChEBI |
| 2-(3-(4-(3H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)-1-(ethylsulfonyl)azetidin-3-yl)acetonitrile | ChEBI |
| INCB 028050 | ChemIDplus |
| INCB-028050 | DrugBank |
| INCB028050 | ChemIDplus |
| LY 3009104 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Olumiant | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 26373084 | ChemSpider |
| 3JW | PDBeChem |
| Baricitinib | Wikipedia |
| D10308 | KEGG DRUG |
| DB11817 | DrugBank |
| HMDB0248873 | HMDB |
| LSM-6709 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1187594-09-7 | ChemIDplus |
| Citations |
|---|