EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N4O7P2S |
| Net Charge | +1 |
| Average Mass | 425.320 |
| Monoisotopic Mass | 425.04442 |
| SMILES | Cc1ncc(C[n+]2csc(CCOP(=O)(O)OP(=O)(O)O)c2C)c(N)n1 |
| InChI | InChI=1S/C12H18N4O7P2S/c1-8-11(3-4-22-25(20,21)23-24(17,18)19)26-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7H,3-4,6H2,1-2H3,(H4-,13,14,15,17,18,19,20,21)/p+1 |
| InChIKey | AYEKOFBPNLCAJY-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (17611796) | |
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (6284709) | ||
| - | PubMed (21988831) | ||
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (12111441) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (12111441) | ||
| blood (UBERON:0000178) | PubMed (17642321) | ||
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS225) | From MetaboLights | |
| - | PubMed (6121420) | ||
| - | MetaboLights (MTBLS292) | From MetaboLights | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (16850348) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiamine(1+) diphosphate (CHEBI:9532) has role cofactor (CHEBI:23357) |
| thiamine(1+) diphosphate (CHEBI:9532) has role fundamental metabolite (CHEBI:78675) |
| thiamine(1+) diphosphate (CHEBI:9532) is a thiamine phosphate (CHEBI:26945) |
| thiamine(1+) diphosphate (CHEBI:9532) is a vitamin B1 (CHEBI:26948) |
| thiamine(1+) diphosphate (CHEBI:9532) is conjugate acid of thiamine(1+) diphosphate(1−) (CHEBI:45931) |
| Incoming Relation(s) |
| thiamine(1+) diphosphate chloride (CHEBI:18290) has part thiamine(1+) diphosphate (CHEBI:9532) |
| thiamine(1+) diphosphate(1−) (CHEBI:45931) is conjugate base of thiamine(1+) diphosphate (CHEBI:9532) |
| IUPAC Name |
|---|
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-[2-(diphosphooxy)ethyl]-4-methyl-1,3-thiazol-3-ium |
| Synonyms | Source |
|---|---|
| 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-4-methyl-5-(4,6,6-trihydroxy-4,6-dioxido-3,5-dioxa-4,6-diphosphahex-1-yl)thiazolium | ChEBI |
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium | IUPAC |
| ThDP | ChEBI |
| thiamin diphosphate | KEGG COMPOUND |
| thiamine diphosphate | KEGG COMPOUND |
| thiamine pyrophosphate | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 1100 | ChemSpider |
| C00019627 | KNApSAcK |
| C00068 | KEGG COMPOUND |
| ECMDB01372 | ECMDB |
| FDB022584 | FooDB |
| HMDB0001372 | HMDB |
| Thiamine_pyrophosphate | Wikipedia |
| TPP | PDBeChem |
| YMDB00381 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3577792 | Reaxys |
| CAS:136-08-3 | ChemIDplus |
| Citations |
|---|