EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO3S |
| Net Charge | 0 |
| Average Mass | 231.317 |
| Monoisotopic Mass | 231.09291 |
| SMILES | CC(C)(CS)C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H17NO3S/c1-10(2,6-15)9(14)11-5-3-4-7(11)8(12)13/h7,15H,3-6H2,1-2H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | UWMLFTFRHALVNS-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-1-(3-mercapto-2,2-dimethyl-1-oxopropyl)-2-pyrrolidinecarboxylic acid (CHEBI:95254) is a N-acyl-amino acid (CHEBI:51569) |
| (2R)-1-(3-mercapto-2,2-dimethyl-1-oxopropyl)-2-pyrrolidinecarboxylic acid (CHEBI:95254) is a tertiary carboxamide (CHEBI:140326) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6577 | LINCS |