EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO3 |
| Net Charge | +1 |
| Average Mass | 160.193 |
| Monoisotopic Mass | 160.09682 |
| SMILES | C[N+]1(C)C[C@H](O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C7H13NO3/c1-8(2)3-5(7(10)11)6(9)4-8/h5-6,9H,3-4H2,1-2H3/p+1/t5-,6+/m1/s1 |
| InChIKey | WTBNMEWVZFFAPJ-RITPCOANSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4R)-4-hydroxy-1,1-dimethyl-3-pyrrolidin-1-iumcarboxylic acid (CHEBI:95225) is a carboxylic acid (CHEBI:33575) |
| (3R,4R)-4-hydroxy-1,1-dimethyl-3-pyrrolidin-1-iumcarboxylic acid (CHEBI:95225) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6528 | LINCS |