EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O |
| Net Charge | 0 |
| Average Mass | 396.659 |
| Monoisotopic Mass | 396.33922 |
| SMILES | C=C1CC[C@H](O)CC1=CC=C1CCC[C@]2(C)C([C@H](C)C=C[C@H](C)C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/t20-,22+,25-,26?,27-,28+/m0/s1 |
| InChIKey | MECHNRXZTMCUDQ-AUNAYUHPSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-3-[2-[(3aS,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylene-1-cyclohexanol (CHEBI:95213) is a vitamin D (CHEBI:27300) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6508 | LINCS |