EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N4O2 |
| Net Charge | 0 |
| Average Mass | 180.167 |
| Monoisotopic Mass | 180.06473 |
| SMILES | Cn1cnc2c1c(=O)nc(=O)n2C |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
| InChIKey | YAPQBXQYLJRXSA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Theobroma cacao (ncbitaxon:3641) | fruit (BTO:0000486) | PubMed (15128023) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. adenosine receptor antagonist An antagonist at any adenosine receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theobromine (CHEBI:28946) has role adenosine receptor antagonist (CHEBI:71232) |
| theobromine (CHEBI:28946) has role bronchodilator agent (CHEBI:35523) |
| theobromine (CHEBI:28946) has role food component (CHEBI:78295) |
| theobromine (CHEBI:28946) has role human blood serum metabolite (CHEBI:85234) |
| theobromine (CHEBI:28946) has role mouse metabolite (CHEBI:75771) |
| theobromine (CHEBI:28946) has role plant metabolite (CHEBI:76924) |
| theobromine (CHEBI:28946) has role vasodilator agent (CHEBI:35620) |
| theobromine (CHEBI:28946) is a dimethylxanthine (CHEBI:23818) |
| IUPAC Name |
|---|
| 3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| Theobromine | KEGG COMPOUND |
| 3,7-dimethylxanthine | ChEBI |
| THEOBROMINE | PDBeChem |
| Theobromin | ChEBI |
| 3,7-dihydro-3,7-dimethyl-1H-purine-2,6-dione | NIST Chemistry WebBook |
| 3,7-dimethylpurine-2,6-dione | DrugBank |
| UniProt Name | Source |
|---|---|
| theobromine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C07480 | KEGG COMPOUND |
| 37T | PDBeChem |
| DB01412 | DrugBank |
| HMDB0002825 | HMDB |
| 3-7-DIMETHYLXANTHINE | MetaCyc |
| Theobromine | Wikipedia |
| C00001509 | KNApSAcK |
| LSM-5483 | LINCS |
| 2618 | DrugCentral |
| Citations |
|---|