EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40N2 |
| Net Charge | 0 |
| Average Mass | 356.598 |
| Monoisotopic Mass | 356.31915 |
| SMILES | C[C@H]1[C@H]2CCC3C4CC=C5C[C@@H](N(C)C)CC[C@]5(C)C4CC[C@@]32CN1C |
| InChI | InChI=1S/C24H40N2/c1-16-20-8-9-22-19-7-6-17-14-18(25(3)4)10-12-23(17,2)21(19)11-13-24(20,22)15-26(16)5/h6,16,18-22H,7-15H2,1-5H3/t16-,18-,19?,20+,21?,22?,23-,24-/m0/s1 |
| InChIKey | GPLGAQQQNWMVMM-YHQZIGKZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-6454 (CHEBI:95174) is a steroid alkaloid (CHEBI:26767) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6454 | LINCS |