EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H50O12 |
| Net Charge | 0 |
| Average Mass | 650.762 |
| Monoisotopic Mass | 650.33023 |
| SMILES | [H][C@]1(OC(=O)/C(C)=C\C)C(C)=C2[C@]3([H])OC(=O)[C@@](C)(O)[C@@]3(O)[C@@H](OC(=O)CCC)C[C@](C)(OC(C)=O)[C@@]2([H])[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C34H50O12/c1-9-12-13-14-15-17-24(37)43-28-26-25(20(5)27(28)44-30(38)19(4)11-3)29-34(41,33(8,40)31(39)45-29)22(42-23(36)16-10-2)18-32(26,7)46-21(6)35/h11,22,26-29,40-41H,9-10,12-18H2,1-8H3/b19-11-/t22-,26+,27-,28-,29-,32-,33+,34+/m0/s1 |
| InChIKey | IXFPJGBNCFXKPI-FSIHEZPISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Ca2+-transporting ATPase (EC 3.6.3.8). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thapsigargin (CHEBI:9516) has role calcium channel blocker (CHEBI:38215) |
| thapsigargin (CHEBI:9516) has role EC 3.6.3.8 (Ca2+-transporting ATPase) inhibitor (CHEBI:60186) |
| thapsigargin (CHEBI:9516) is a butyrate ester (CHEBI:50477) |
| thapsigargin (CHEBI:9516) is a organic heterotricyclic compound (CHEBI:26979) |
| thapsigargin (CHEBI:9516) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3S,3aR,4S,6S,6aR,7S,8S,9bS)-6-(acetyloxy)-4-(butanoyloxy)-3,3a-dihydroxy-3,6,9-trimethyl-8-{[(2Z)-2-methylbut-2-enoyl]oxy}-2-oxo-2,3,3a,4,5,6,6a,7,8,9b-decahydroazuleno[4,5-b]furan-7-yl octanoate |
| Synonyms | Source |
|---|---|
| Thapsigargin | KEGG COMPOUND |
| octanoic acid {3S-[3α,3aβ,4α,6β,6aβ,7β,8α(Z),9bα]}-6-(acetoxy)-2,3,3a,4,5,6,6a,7,8,9b-decahydro-3,3a-dihydroxy-3,6,9-trimethyl-8-[(2-methyl-1-oxo-2-butenyl)oxy]-2-oxo-4-(1-oxobutoxy)-azuleno[4,5-b]furan-7-yl ester | ChEBI |
| thapsigargine | ChEBI |
| Tg | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09561 | KEGG COMPOUND |
| TG1 | PDBeChem |
| LMPR0103410001 | LIPID MAPS |
| Thapsigargin | Wikipedia |
| C00003375 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4649293 | Reaxys |
| CAS:67526-95-8 | ChemIDplus |
| Citations |
|---|