EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O6 |
| Net Charge | 0 |
| Average Mass | 470.606 |
| Monoisotopic Mass | 470.26684 |
| SMILES | CC1=C(CO)C(=O)O[C@H](C(C)[C@H]2CCC3[C@H]4C[C@H]5O[C@@]56[C@@H](O)C=CC(=O)[C@@]6(C)C4CC[C@]32C)C1 |
| InChI | InChI=1S/C28H38O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h7-8,15-16,18-21,23-24,29,31H,5-6,9-13H2,1-4H3/t15?,16-,18-,19?,20?,21+,23+,24-,26+,27-,28+/m1/s1 |
| InChIKey | DBRXOUCRJQVYJQ-QLOZTKJNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-6432 (CHEBI:95158) is a withanolide (CHEBI:74716) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6432 | LINCS |