EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H17F2N5O3S |
| Net Charge | 0 |
| Average Mass | 505.506 |
| Monoisotopic Mass | 505.10202 |
| SMILES | COc1ncc(-c2ccc3nccc(-c4ccnnc4)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H17F2N5O3S/c1-35-25-23(32-36(33,34)24-5-3-18(26)12-21(24)27)11-17(13-29-25)15-2-4-22-20(10-15)19(7-8-28-22)16-6-9-30-31-14-16/h2-14,32H,1H3 |
| InChIKey | CGBJSGAELGCMKE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| omipalisib (CHEBI:95093) has role anticoronaviral agent (CHEBI:149553) |
| omipalisib (CHEBI:95093) has role antifibrotic agent (CHEBI:233423) |
| omipalisib (CHEBI:95093) has role antineoplastic agent (CHEBI:35610) |
| omipalisib (CHEBI:95093) has role autophagy inducer (CHEBI:138880) |
| omipalisib (CHEBI:95093) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| omipalisib (CHEBI:95093) has role mTOR inhibitor (CHEBI:68481) |
| omipalisib (CHEBI:95093) has role radiosensitizing agent (CHEBI:132992) |
| omipalisib (CHEBI:95093) is a aromatic ether (CHEBI:35618) |
| omipalisib (CHEBI:95093) is a difluorobenzene (CHEBI:38582) |
| omipalisib (CHEBI:95093) is a pyridazines (CHEBI:37921) |
| omipalisib (CHEBI:95093) is a pyridines (CHEBI:26421) |
| omipalisib (CHEBI:95093) is a quinolines (CHEBI:26513) |
| omipalisib (CHEBI:95093) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 2,4-difluoro-N-{2-methoxy-5-[4-(pyridazin-4-yl)quinolin-6-yl]pyridin-3-yl}benzenesulfonamide |
| INNs | Source |
|---|---|
| omipalisib | WHO MedNet |
| omipalisib | WHO MedNet |
| omipalisib | WHO MedNet |
| omipalisibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,4-difluoro-N-[2-methoxy-5-[4-(4-pyridazinyl)-6-quinolinyl]-3-pyridinyl]benzenesulfonamide | ChEBI |
| 2,4-difluoro-N-{2-methoxy-5-[4-(pyridazin-4-yl)quinolin-6-yl]pyridin-3-yl}benzene-1-sulfonamide | IUPAC |
| 2,4-difluoro-N-[2-methoxy-5-(4-pyridazin-4-ylquinolin-6-yl)pyridin-3-yl]benzenesulfonamide | PDBeChem |
| GSK 212 | ChemIDplus |
| GSK-212 | ChemIDplus |
| GSK212 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1086062-66-9 | ChemIDplus |
| Citations |
|---|