EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H17F2N5O3S |
| Net Charge | 0 |
| Average Mass | 505.506 |
| Monoisotopic Mass | 505.10202 |
| SMILES | COc1ncc(-c2ccc3nccc(-c4ccnnc4)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H17F2N5O3S/c1-35-25-23(32-36(33,34)24-5-3-18(26)12-21(24)27)11-17(13-29-25)15-2-4-22-20(10-15)19(7-8-28-22)16-6-9-30-31-14-16/h2-14,32H,1H3 |
| InChIKey | CGBJSGAELGCMKE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| omipalisib (CHEBI:95093) has role anticoronaviral agent (CHEBI:149553) |
| omipalisib (CHEBI:95093) has role antifibrotic agent (CHEBI:233423) |
| omipalisib (CHEBI:95093) has role antineoplastic agent (CHEBI:35610) |
| omipalisib (CHEBI:95093) has role autophagy inducer (CHEBI:138880) |
| omipalisib (CHEBI:95093) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| omipalisib (CHEBI:95093) has role mTOR inhibitor (CHEBI:68481) |
| omipalisib (CHEBI:95093) has role radiosensitizing agent (CHEBI:132992) |
| omipalisib (CHEBI:95093) is a aromatic ether (CHEBI:35618) |
| omipalisib (CHEBI:95093) is a difluorobenzene (CHEBI:38582) |
| omipalisib (CHEBI:95093) is a pyridazines (CHEBI:37921) |
| omipalisib (CHEBI:95093) is a pyridines (CHEBI:26421) |
| omipalisib (CHEBI:95093) is a quinolines (CHEBI:26513) |
| omipalisib (CHEBI:95093) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 2,4-difluoro-N-{2-methoxy-5-[4-(pyridazin-4-yl)quinolin-6-yl]pyridin-3-yl}benzenesulfonamide |
| INNs | Source |
|---|---|
| omipalisib | WHO MedNet |
| omipalisib | WHO MedNet |
| omipalisib | WHO MedNet |
| omipalisibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,4-difluoro-N-[2-methoxy-5-[4-(4-pyridazinyl)-6-quinolinyl]-3-pyridinyl]benzenesulfonamide | ChEBI |
| 2,4-difluoro-N-{2-methoxy-5-[4-(pyridazin-4-yl)quinolin-6-yl]pyridin-3-yl}benzene-1-sulfonamide | IUPAC |
| 2,4-difluoro-N-[2-methoxy-5-(4-pyridazin-4-ylquinolin-6-yl)pyridin-3-yl]benzenesulfonamide | PDBeChem |
| GSK 212 | ChemIDplus |
| GSK-212 | ChemIDplus |
| GSK212 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1086062-66-9 | ChemIDplus |
| Citations |
|---|