EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32ClN5O2 |
| Net Charge | 0 |
| Average Mass | 458.006 |
| Monoisotopic Mass | 457.22445 |
| SMILES | CC(C)NC[C@@H](C(=O)N1CCN(c2ncnc3c2[C@H](C)C[C@H]3O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN5O2/c1-15(2)26-13-19(17-4-6-18(25)7-5-17)24(32)30-10-8-29(9-11-30)23-21-16(3)12-20(31)22(21)27-14-28-23/h4-7,14-16,19-20,26,31H,8-13H2,1-3H3/t16-,19-,20-/m1/s1 |
| InChIKey | GRZXWCHAXNAUHY-NSISKUIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-(4-chlorophenyl)-1-[4-[(5R,7R)-7-hydroxy-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1-piperazinyl]-3-(propan-2-ylamino)-1-propanone (CHEBI:95089) has role antineoplastic agent (CHEBI:35610) |
| (2S)-2-(4-chlorophenyl)-1-[4-[(5R,7R)-7-hydroxy-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1-piperazinyl]-3-(propan-2-ylamino)-1-propanone (CHEBI:95089) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| ipatasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| GDC-0068 | ChEMBL |
| ipatasertib | ChEMBL |
| RG-7440 | ChEMBL |
| RG7440 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6341 | LINCS |
| Citations |
|---|