EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25ClN4O2S |
| Net Charge | 0 |
| Average Mass | 456.999 |
| Monoisotopic Mass | 456.13867 |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C23H25ClN4O2S/c1-12-13(2)31-22-19(12)20(15-7-9-16(24)10-8-15)25-17(11-18(29)30-23(4,5)6)21-27-26-14(3)28(21)22/h7-10,17H,11H2,1-6H3/t17-/m0/s1 |
| InChIKey | DNVXATUJJDPFDM-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. bromodomain-containing protein 4 inhibitor Any inhibitor of bromodomain-containing protein 4 (BRD4). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JQ1 (CHEBI:137113) has role angiogenesis inhibitor (CHEBI:48422) |
| JQ1 (CHEBI:137113) has role anti-inflammatory agent (CHEBI:67079) |
| JQ1 (CHEBI:137113) has role antineoplastic agent (CHEBI:35610) |
| JQ1 (CHEBI:137113) has role apoptosis inducer (CHEBI:68495) |
| JQ1 (CHEBI:137113) has role bromodomain-containing protein 4 inhibitor (CHEBI:137114) |
| JQ1 (CHEBI:137113) has role cardioprotective agent (CHEBI:77307) |
| JQ1 (CHEBI:137113) has role ferroptosis inducer (CHEBI:173085) |
| JQ1 (CHEBI:137113) is a tert-butyl ester (CHEBI:140402) |
| JQ1 (CHEBI:137113) is a carboxylic ester (CHEBI:33308) |
| JQ1 (CHEBI:137113) is a organochlorine compound (CHEBI:36683) |
| JQ1 (CHEBI:137113) is a thienotriazolodiazepine (CHEBI:84232) |
| IUPAC Name |
|---|
| tert-butyl [(6S)-4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl]acetate |
| Synonyms | Source |
|---|---|
| (+)-JQ1 | ChEBI |
| JQ1 Compound | ChemIDplus |
| (S)-JQ1 | ChemIDplus |
| (S)-(+)-tert-Butyl 2-(4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno(3,2-f)(1,2,4)triazolo(4,3-a)(1,4)diazepin-6-yl)acetate | ChemIDplus |
| TEN-010 | ChEBI |
| UniProt Name | Source |
|---|---|
| JQ1 | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21994154 | Reaxys |
| CAS:1268524-70-4 | ChemIDplus |
| Citations |
|---|