EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25ClN4O2S |
| Net Charge | 0 |
| Average Mass | 456.999 |
| Monoisotopic Mass | 456.13867 |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C23H25ClN4O2S/c1-12-13(2)31-22-19(12)20(15-7-9-16(24)10-8-15)25-17(11-18(29)30-23(4,5)6)21-27-26-14(3)28(21)22/h7-10,17H,11H2,1-6H3/t17-/m0/s1 |
| InChIKey | DNVXATUJJDPFDM-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bromodomain-containing protein 4 inhibitor Any inhibitor of bromodomain-containing protein 4 (BRD4). ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JQ1 (CHEBI:137113) has role angiogenesis inhibitor (CHEBI:48422) |
| JQ1 (CHEBI:137113) has role anti-inflammatory agent (CHEBI:67079) |
| JQ1 (CHEBI:137113) has role antineoplastic agent (CHEBI:35610) |
| JQ1 (CHEBI:137113) has role apoptosis inducer (CHEBI:68495) |
| JQ1 (CHEBI:137113) has role bromodomain-containing protein 4 inhibitor (CHEBI:137114) |
| JQ1 (CHEBI:137113) has role cardioprotective agent (CHEBI:77307) |
| JQ1 (CHEBI:137113) has role ferroptosis inducer (CHEBI:173085) |
| JQ1 (CHEBI:137113) is a tert-butyl ester (CHEBI:140402) |
| JQ1 (CHEBI:137113) is a carboxylic ester (CHEBI:33308) |
| JQ1 (CHEBI:137113) is a organochlorine compound (CHEBI:36683) |
| JQ1 (CHEBI:137113) is a thienotriazolodiazepine (CHEBI:84232) |
| IUPAC Name |
|---|
| tert-butyl [(6S)-4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl]acetate |
| Synonyms | Source |
|---|---|
| (+)-JQ1 | ChEBI |
| JQ1 Compound | ChemIDplus |
| (S)-JQ1 | ChemIDplus |
| (S)-(+)-tert-Butyl 2-(4-(4-chlorophenyl)-2,3,9-trimethyl-6H-thieno(3,2-f)(1,2,4)triazolo(4,3-a)(1,4)diazepin-6-yl)acetate | ChemIDplus |
| TEN-010 | ChEBI |
| UniProt Name | Source |
|---|---|
| JQ1 | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21994154 | Reaxys |
| CAS:1268524-70-4 | ChemIDplus |
| Citations |
|---|