EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H19N4O6P |
| Net Charge | 0 |
| Average Mass | 298.236 |
| Monoisotopic Mass | 298.10422 |
| SMILES | CN(C)[C@@H](COP(=O)(O)OCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C8H19N4O6P/c1-12(2)6(7(13)14)5-18-19(15,16)17-4-3-11-8(9)10/h6H,3-5H2,1-2H3,(H,13,14)(H,15,16)(H4,9,10,11)/t6-/m0/s1 |
| InChIKey | FRAIHXIYAIPKII-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thalassemine (CHEBI:9508) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Synonyms | Source |
|---|---|
| L-Thalassemine | KEGG COMPOUND |
| Thalassemine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01961 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:40524-74-1 | KEGG COMPOUND |