EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31N3O6 |
| Net Charge | 0 |
| Average Mass | 505.571 |
| Monoisotopic Mass | 505.22129 |
| SMILES | COC(=O)/C=C/C(=O)N(O)CCCCNCc1ccc(COC(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H31N3O6/c1-36-27(33)16-15-26(32)31(35)18-5-4-17-29-19-21-11-13-22(14-12-21)20-37-28(34)30-25-10-6-8-23-7-2-3-9-24(23)25/h2-3,6-16,29,35H,4-5,17-20H2,1H3,(H,30,34)/b16-15+ |
| InChIKey | MUJOCHRZXRZONW-FOCLMDBBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylstat (CHEBI:95078) has role antineoplastic agent (CHEBI:35610) |
| methylstat (CHEBI:95078) has role apoptosis inducer (CHEBI:68495) |
| methylstat (CHEBI:95078) is a benzenes (CHEBI:22712) |
| methylstat (CHEBI:95078) is a carbamate ester (CHEBI:23003) |
| methylstat (CHEBI:95078) is a enamide (CHEBI:51751) |
| methylstat (CHEBI:95078) is a enoate ester (CHEBI:51702) |
| methylstat (CHEBI:95078) is a hydroxamic acid (CHEBI:24650) |
| methylstat (CHEBI:95078) is a methyl ester (CHEBI:25248) |
| methylstat (CHEBI:95078) is a naphthalenes (CHEBI:25477) |
| methylstat (CHEBI:95078) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| methyl (2E)-4-(hydroxy{4-[(4-{[(naphthalen-1-ylcarbamoyl)oxy]methyl}benzyl)amino]butyl}amino)-4-oxobut-2-enoate |
| Synonym | Source |
|---|---|
| (2E)-4-[hydroxy[4-[[[4-[[[(1-naphthalenylamino)carbonyl]oxy]methyl]phenyl]methyl]amino]butyl]amino]-4-oxo-2-butenoic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-43292 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1310877-95-2 | ChEBI |
| Citations |
|---|