EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N5O2 |
| Net Charge | 0 |
| Average Mass | 417.513 |
| Monoisotopic Mass | 417.21648 |
| SMILES | CCOC(=O)CCNc1cc(N2CCc3ccccc3CC2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C24H27N5O2/c1-2-31-23(30)10-14-26-21-17-22(28-24(27-21)20-9-5-6-13-25-20)29-15-11-18-7-3-4-8-19(18)12-16-29/h3-9,13,17H,2,10-12,14-16H2,1H3,(H,26,27,28) |
| InChIKey | WBKCKEHGXNWYMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.14.11.68 ([histone H3]-trimethyl-L-lysine(27) demethylase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of [histone H3]-trimethyl-L-lysine27 demethylase (EC 1.14.11.68). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK-J4 (CHEBI:95077) has functional parent GSK-J1 (CHEBI:131152) |
| GSK-J4 (CHEBI:95077) has role antineoplastic agent (CHEBI:35610) |
| GSK-J4 (CHEBI:95077) has role EC 1.14.11.68 ([histone H3]-trimethyl-L-lysine27 demethylase) inhibitor (CHEBI:233404) |
| GSK-J4 (CHEBI:95077) has role ferroptosis inducer (CHEBI:173085) |
| GSK-J4 (CHEBI:95077) has role prodrug (CHEBI:50266) |
| GSK-J4 (CHEBI:95077) is a aminopyrimidine (CHEBI:38338) |
| GSK-J4 (CHEBI:95077) is a benzazepine (CHEBI:35676) |
| GSK-J4 (CHEBI:95077) is a ethyl ester (CHEBI:23990) |
| GSK-J4 (CHEBI:95077) is a pyridines (CHEBI:26421) |
| GSK-J4 (CHEBI:95077) is a secondary amino compound (CHEBI:50995) |
| GSK-J4 (CHEBI:95077) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| ethyl N-[2-(pyridin-2-yl)-6-(1,2,4,5-tetrahydro-3H-3-benzazepin-3-yl)pyrimidin-4-yl]-β-alaninate |
| Synonyms | Source |
|---|---|
| 3-[[2-(2-pyridinyl)-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)-4-pyrimidinyl]amino]propanoic acid ethyl ester | ChEBI |
| ethyl 3-((2-(pyridin-2-yl)-6-(1,2,4,5-tetrahydro-3H-benzo[d]azepin-3-yl)pyrimidin-4-yl)amino)propanoate | ChEBI |
| GSK J4 | ChEBI |
| GSKJ4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0252948 | HMDB |
| LSM-6328 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1373423-53-0 | ChEBI |
| Citations |
|---|