EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N5O2 |
| Net Charge | 0 |
| Average Mass | 417.513 |
| Monoisotopic Mass | 417.21648 |
| SMILES | CCOC(=O)CCNc1cc(N2CCc3ccccc3CC2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C24H27N5O2/c1-2-31-23(30)10-14-26-21-17-22(28-24(27-21)20-9-5-6-13-25-20)29-15-11-18-7-3-4-8-19(18)12-16-29/h3-9,13,17H,2,10-12,14-16H2,1H3,(H,26,27,28) |
| InChIKey | WBKCKEHGXNWYMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.11.68 ([histone H3]-trimethyl-L-lysine(27) demethylase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of [histone H3]-trimethyl-L-lysine27 demethylase (EC 1.14.11.68). ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK-J4 (CHEBI:95077) has functional parent GSK-J1 (CHEBI:131152) |
| GSK-J4 (CHEBI:95077) has role antineoplastic agent (CHEBI:35610) |
| GSK-J4 (CHEBI:95077) has role EC 1.14.11.68 ([histone H3]-trimethyl-L-lysine27 demethylase) inhibitor (CHEBI:233404) |
| GSK-J4 (CHEBI:95077) has role ferroptosis inducer (CHEBI:173085) |
| GSK-J4 (CHEBI:95077) has role prodrug (CHEBI:50266) |
| GSK-J4 (CHEBI:95077) is a aminopyrimidine (CHEBI:38338) |
| GSK-J4 (CHEBI:95077) is a benzazepine (CHEBI:35676) |
| GSK-J4 (CHEBI:95077) is a ethyl ester (CHEBI:23990) |
| GSK-J4 (CHEBI:95077) is a pyridines (CHEBI:26421) |
| GSK-J4 (CHEBI:95077) is a secondary amino compound (CHEBI:50995) |
| GSK-J4 (CHEBI:95077) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| ethyl N-[2-(pyridin-2-yl)-6-(1,2,4,5-tetrahydro-3H-3-benzazepin-3-yl)pyrimidin-4-yl]-β-alaninate |
| Synonyms | Source |
|---|---|
| 3-[[2-(2-pyridinyl)-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)-4-pyrimidinyl]amino]propanoic acid ethyl ester | ChEBI |
| ethyl 3-((2-(pyridin-2-yl)-6-(1,2,4,5-tetrahydro-3H-benzo[d]azepin-3-yl)pyrimidin-4-yl)amino)propanoate | ChEBI |
| GSK J4 | ChEBI |
| GSKJ4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0252948 | HMDB |
| LSM-6328 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1373423-53-0 | ChEBI |
| Citations |
|---|