EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H47N5O2 |
| Net Charge | 0 |
| Average Mass | 509.739 |
| Monoisotopic Mass | 509.37298 |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(C3CCCCC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C30H47N5O2/c1-22(2)35-17-12-24(13-18-35)31-30-25-20-27(36-3)28(37-19-9-16-34-14-7-8-15-34)21-26(25)32-29(33-30)23-10-5-4-6-11-23/h20-24H,4-19H2,1-3H3,(H,31,32,33) |
| InChIKey | QOECJCJVIMVJGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UNC0638 (CHEBI:95074) has role antineoplastic agent (CHEBI:35610) |
| UNC0638 (CHEBI:95074) has role antiviral agent (CHEBI:22587) |
| UNC0638 (CHEBI:95074) is a aminopiperidine (CHEBI:48588) |
| UNC0638 (CHEBI:95074) is a aromatic ether (CHEBI:35618) |
| UNC0638 (CHEBI:95074) is a pyrrolidines (CHEBI:38260) |
| UNC0638 (CHEBI:95074) is a quinazolines (CHEBI:38530) |
| UNC0638 (CHEBI:95074) is a secondary amino compound (CHEBI:50995) |
| UNC0638 (CHEBI:95074) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-cyclohexyl-6-methoxy-N-[1-(propan-2-yl)piperidin-4-yl]-7-[3-(pyrrolidin-1-yl)propoxy]quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| 2-cyclohexyl-6-methoxy-N-(1-propan-2-yl-4-piperidinyl)-7-[3-(1-pyrrolidinyl)propoxy]-4-quinazolinamine | ChEBI |
| UNC-0638 | ChEBI |
| UNC 0638 | ChEBI |
| 2-cyclohexyl-6-methoxy-N-[1-(1-methylethyl)-4-piperidinyl]-7-[3-(1-pyrrolidinyl)propoxy]-4-quinazolinamin | ChEBI |
| 2-cyclohexyl-N-(1-isopropylpiperidin-4-yl)-6-methoxy-7-(3-(pyrrolidin-1-yl)propoxy) quinazolin-4-amine | ChEBI |
| 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine | ChEBI |
| Citations |
|---|