EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N5O3 |
| Net Charge | 0 |
| Average Mass | 433.512 |
| Monoisotopic Mass | 433.21139 |
| SMILES | O=C(CCCCCCNC(=O)c1cnc(N(c2ccccc2)c2ccccc2)nc1)NO |
| InChI | InChI=1S/C24H27N5O3/c30-22(28-32)15-9-1-2-10-16-25-23(31)19-17-26-24(27-18-19)29(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-8,11-14,17-18,32H,1-2,9-10,15-16H2,(H,25,31)(H,28,30) |
| InChIKey | QGZYDVAGYRLSKP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ricolinostat (CHEBI:95073) has role anti-inflammatory agent (CHEBI:67079) |
| ricolinostat (CHEBI:95073) has role antineoplastic agent (CHEBI:35610) |
| ricolinostat (CHEBI:95073) has role apoptosis inducer (CHEBI:68495) |
| ricolinostat (CHEBI:95073) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| ricolinostat (CHEBI:95073) is a hydroxamic acid (CHEBI:24650) |
| ricolinostat (CHEBI:95073) is a pyrimidinecarboxamide (CHEBI:48438) |
| ricolinostat (CHEBI:95073) is a secondary carboxamide (CHEBI:140325) |
| ricolinostat (CHEBI:95073) is a substituted aniline (CHEBI:48975) |
| ricolinostat (CHEBI:95073) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-(diphenylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide |
| INNs | Source |
|---|---|
| ricolinostat | WHO MedNet |
| ricolinostat | WHO MedNet |
| ricolinostat | WHO MedNet |
| ricolinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACY 1215 | ChEBI |
| ACY-1215 | DrugBank |
| ACY1215 | ChEBI |
| ACY-63 | DrugBank |
| N-[7-(hydroxyamino)-7-oxoheptyl]-2-(N-phenylanilino)-5-pyrimidinecarboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| AH4 | PDBeChem |
| D10661 | KEGG DRUG |
| DB12376 | DrugBank |
| HMDB0244543 | HMDB |
| LSM-6324 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1316214-52-4 | KEGG DRUG |
| Citations |
|---|