EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N4O2 |
| Net Charge | 0 |
| Average Mass | 358.486 |
| Monoisotopic Mass | 358.23688 |
| SMILES | CCCCc1nc2cc(/C=C/C(=O)NO)ccc2n1CCN(CC)CC |
| InChI | InChI=1S/C20H30N4O2/c1-4-7-8-19-21-17-15-16(10-12-20(25)22-26)9-11-18(17)24(19)14-13-23(5-2)6-3/h9-12,15,26H,4-8,13-14H2,1-3H3,(H,22,25)/b12-10+ |
| InChIKey | JHDKZFFAIZKUCU-ZRDIBKRKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pracinostat (CHEBI:95071) has role antimalarial (CHEBI:38068) |
| pracinostat (CHEBI:95071) has role antineoplastic agent (CHEBI:35610) |
| pracinostat (CHEBI:95071) has role apoptosis inducer (CHEBI:68495) |
| pracinostat (CHEBI:95071) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| pracinostat (CHEBI:95071) is a benzimidazole (CHEBI:36622) |
| pracinostat (CHEBI:95071) is a hydroxamic acid (CHEBI:24650) |
| pracinostat (CHEBI:95071) is a olefinic compound (CHEBI:78840) |
| pracinostat (CHEBI:95071) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2E)-3-{2-butyl-1-[2-(diethylamino)ethyl]-1H-benzimidazol-5-yl}-N-hydroxyacrylamide |
| INNs | Source |
|---|---|
| pracinostat | ChemIDplus |
| pracinostat | WHO MedNet |
| pracinostat | WHO MedNet |
| pracinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SB 939 | ChemIDplus |
| SB-939 | ChemIDplus |
| SB939 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB05223 | DrugBank |
| LSM-43290 | LINCS |
| Pracinostat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:929016-96-6 | ChemIDplus |
| Citations |
|---|