EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:95071 - pracinostat
| Formula | C20H30N4O2 |
| Net Charge | 0 |
| Average Mass | 358.486 |
| Monoisotopic Mass | 358.23688 |
| SMILES | CCCCc1nc2cc(/C=C/C(=O)NO)ccc2n1CCN(CC)CC |
| InChI | InChI=1S/C20H30N4O2/c1-4-7-8-19-21-17-15-16(10-12-20(25)22-26)9-11-18(17)24(19)14-13-23(5-2)6-3/h9-12,15,26H,4-8,13-14H2,1-3H3,(H,22,25)/b12-10+ |
| InChIKey | JHDKZFFAIZKUCU-ZRDIBKRKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pracinostat (CHEBI:95071) has role antimalarial (CHEBI:38068) |
| pracinostat (CHEBI:95071) has role antineoplastic agent (CHEBI:35610) |
| pracinostat (CHEBI:95071) has role apoptosis inducer (CHEBI:68495) |
| pracinostat (CHEBI:95071) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| pracinostat (CHEBI:95071) is a benzimidazole (CHEBI:36622) |
| pracinostat (CHEBI:95071) is a hydroxamic acid (CHEBI:24650) |
| pracinostat (CHEBI:95071) is a olefinic compound (CHEBI:78840) |
| pracinostat (CHEBI:95071) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2E)-3-{2-butyl-1-[2-(diethylamino)ethyl]-1H-benzimidazol-5-yl}-N-hydroxyacrylamide |
| INNs | Source |
|---|---|
| pracinostat | ChemIDplus |
| pracinostat | WHO MedNet |
| pracinostat | WHO MedNet |
| pracinostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SB 939 | ChemIDplus |
| SB-939 | ChemIDplus |
| SB939 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB05223 | DrugBank |
| LSM-43290 | LINCS |
| Pracinostat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:929016-96-6 | ChemIDplus |
| Citations |
|---|