EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5IN2O3 |
| Net Charge | 0 |
| Average Mass | 292.032 |
| Monoisotopic Mass | 291.93449 |
| SMILES | NC(=O)c1ccc(I)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5IN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| InChIKey | MDOJTZQKHMAPBK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-iodo-3-nitrobenzamide (CHEBI:95067) has role antineoplastic agent (CHEBI:35610) |
| 4-iodo-3-nitrobenzamide (CHEBI:95067) has role antiviral agent (CHEBI:22587) |
| 4-iodo-3-nitrobenzamide (CHEBI:95067) is a carbonyl compound (CHEBI:36586) |
| 4-iodo-3-nitrobenzamide (CHEBI:95067) is a organohalogen compound (CHEBI:17792) |
| INN | Source |
|---|---|
| iniparib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BSI-201 | ChEMBL |
| iniparib | ChEMBL |
| Sar-240550 | ChEMBL |
| SAR240550 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6317 | LINCS |
| Citations |
|---|