EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22F3N5O |
| Net Charge | 0 |
| Average Mass | 405.424 |
| Monoisotopic Mass | 405.17764 |
| SMILES | CN1CCC(CNc2ccc3ncc(-c4cccc(OC(F)(F)F)c4)n3n2)CC1 |
| InChI | InChI=1S/C20H22F3N5O/c1-27-9-7-14(8-10-27)12-24-18-5-6-19-25-13-17(28(19)26-18)15-3-2-4-16(11-15)29-20(21,22)23/h2-6,11,13-14H,7-10,12H2,1H3,(H,24,26) |
| InChIKey | MHXGEROHKGDZGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(1-methyl-4-piperidinyl)methyl]-3-[3-(trifluoromethoxy)phenyl]-6-imidazo[1,2-b]pyridazinamine (CHEBI:95061) has role antineoplastic agent (CHEBI:35610) |
| N-[(1-methyl-4-piperidinyl)methyl]-3-[3-(trifluoromethoxy)phenyl]-6-imidazo[1,2-b]pyridazinamine (CHEBI:95061) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| sgi-1776 | ChEMBL |
| Sgi-1776 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6307 | LINCS |
| Citations |
|---|