EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O2 |
| Net Charge | 0 |
| Average Mass | 310.437 |
| Monoisotopic Mass | 310.19328 |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H26O2/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)19-13-15-20(16-14-19)21(22)23/h9-16H,2-8H2,1H3,(H,22,23) |
| InChIKey | HXBKPYIEQLLNBK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(4-octylphenyl)benzoic acid (CHEBI:95048) is a biphenyls (CHEBI:22888) |
| 4-(4-octylphenyl)benzoic acid (CHEBI:95048) is a carboxybiphenyl (CHEBI:141493) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6290 | LINCS |