EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N2O6 |
| Net Charge | 0 |
| Average Mass | 406.479 |
| Monoisotopic Mass | 406.21039 |
| SMILES | CC(C)C[C@@H](C(=O)N[C@H](C(=O)OC1CCCC1)c1ccccc1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C21H30N2O6/c1-13(2)12-16(18(24)20(26)23-28)19(25)22-17(14-8-4-3-5-9-14)21(27)29-15-10-6-7-11-15/h3-5,8-9,13,15-18,24,28H,6-7,10-12H2,1-2H3,(H,22,25)(H,23,26)/t16-,17+,18+/m1/s1 |
| InChIKey | FWFGIHPGRQZWIW-SQNIBIBYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]amino]-2-phenylacetic acid cyclopentyl ester (CHEBI:95044) has role antineoplastic agent (CHEBI:35610) |
| (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]amino]-2-phenylacetic acid cyclopentyl ester (CHEBI:95044) is a carboxylic ester (CHEBI:33308) |
| (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]amino]-2-phenylacetic acid cyclopentyl ester (CHEBI:95044) is a hydroxamic acid (CHEBI:24650) |
| (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]amino]-2-phenylacetic acid cyclopentyl ester (CHEBI:95044) is a secondary carboxamide (CHEBI:140325) |
| INN | Source |
|---|---|
| tosedostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| CHR 2797 | ChEMBL |
| CHR-2797 | ChEMBL |
| CHR2797 | ChEMBL |
| tosedostat | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6286 | LINCS |
| Citations |
|---|