EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17N3O4S |
| Net Charge | 0 |
| Average Mass | 371.418 |
| Monoisotopic Mass | 371.09398 |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccnc2Nc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-25-15-8-10-16(11-9-15)26(23,24)21-17-3-2-12-19-18(17)20-13-4-6-14(22)7-5-13/h2-12,21-22H,1H3,(H,19,20) |
| InChIKey | URCVCIZFVQDVPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(4-hydroxyanilino)-3-pyridinyl]-4-methoxybenzenesulfonamide (CHEBI:95043) has role antineoplastic agent (CHEBI:35610) |
| N-[2-(4-hydroxyanilino)-3-pyridinyl]-4-methoxybenzenesulfonamide (CHEBI:95043) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| abt-751 | ChEMBL |
| Abt-751 | ChEMBL |
| E 7010 | ChEMBL |
| E-7010 | ChEMBL |
| NSC-742134 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6285 | LINCS |
| Citations |
|---|