EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N3O3 |
| Net Charge | +1 |
| Average Mass | 172.164 |
| Monoisotopic Mass | 172.07167 |
| SMILES | N#[N+]CC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H9N3O3/c7-5(6(11)12)2-1-4(10)3-9-8/h5H,1-3,7H2/p+1/t5-/m0/s1 |
| InChIKey | UUTYCZUIECRVAL-YFKPBYRVSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S)-5-amino-6-hydroxy-2,6-dioxohexane-1-diazonium (CHEBI:95038) is a L-α-amino acid (CHEBI:15705) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6278 | LINCS |