EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N6O2 |
| Net Charge | 0 |
| Average Mass | 434.544 |
| Monoisotopic Mass | 434.24302 |
| SMILES | CCC[C@H](Nc1nc(-c2ccc(NC(=O)NCC)c(OC)c2)ncc1C)c1cccnc1 |
| InChI | InChI=1S/C24H30N6O2/c1-5-8-19(18-9-7-12-25-15-18)28-22-16(3)14-27-23(30-22)17-10-11-20(21(13-17)32-4)29-24(31)26-6-2/h7,9-15,19H,5-6,8H2,1-4H3,(H2,26,29,31)(H,27,28,30)/t19-/m0/s1 |
| InChIKey | MTJHLONVHHPNSI-IBGZPJMESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-ethyl-3-[2-methoxy-4-[5-methyl-4-[[(1S)-1-(3-pyridinyl)butyl]amino]-2-pyrimidinyl]phenyl]urea (CHEBI:95005) has role antineoplastic agent (CHEBI:35610) |
| 1-ethyl-3-[2-methoxy-4-[5-methyl-4-[[(1S)-1-(3-pyridinyl)butyl]amino]-2-pyrimidinyl]phenyl]urea (CHEBI:95005) is a ureas (CHEBI:47857) |
| INNs | Source |
|---|---|
| lexibulin | WHO MedNet |
| lexibulina | WHO MedNet |
| lexibuline | WHO MedNet |
| Synonyms | Source |
|---|---|
| CYT 997 | ChEMBL |
| CYT-997 | ChEMBL |
| CYT997 | ChEMBL |
| lexibulin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6232 | LINCS |
| Citations |
|---|