EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O6 |
| Net Charge | 0 |
| Average Mass | 380.356 |
| Monoisotopic Mass | 380.10084 |
| SMILES | O=C(Nc1cccc(NC(=O)c2cccc(O)c2O)c1)c1cccc(O)c1O |
| InChI | InChI=1S/C20H16N2O6/c23-15-8-2-6-13(17(15)25)19(27)21-11-4-1-5-12(10-11)22-20(28)14-7-3-9-16(24)18(14)26/h1-10,23-26H,(H,21,27)(H,22,28) |
| InChIKey | MIQUEZGHEJGPJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MST-312 (CHEBI:95003) has role antineoplastic agent (CHEBI:35610) |
| MST-312 (CHEBI:95003) has role apoptosis inducer (CHEBI:68495) |
| MST-312 (CHEBI:95003) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| MST-312 (CHEBI:95003) is a benzamides (CHEBI:22702) |
| MST-312 (CHEBI:95003) is a catechols (CHEBI:33566) |
| MST-312 (CHEBI:95003) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N,N'-benzene-1,3-diylbis(2,3-dihydroxybenzamide) |
| Synonyms | Source |
|---|---|
| N-[3-[[(2,3-dihydroxyphenyl)-oxomethyl]amino]phenyl]-2,3-dihydroxybenzamide | ChEBI |
| N,N'-(1,3-phenylene)bis(2,3-dihydroxybenzamide) | IUPAC |
| N,N'-bis(2,3-dihydroxybenzoyl)-1,3-phenylenediamine | ChEBI |
| MST 312 | ChEBI |
| MST312 | ChEBI |
| telomerase inhibitor IX | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6230 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:368449-04-1 | ChEBI |
| Citations |
|---|