EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N5 |
| Net Charge | 0 |
| Average Mass | 371.488 |
| Monoisotopic Mass | 371.21100 |
| SMILES | CC(C)c1ccc(Cn2ccc3c4c(N)nc(NC5CC5)nc4ccc32)cc1 |
| InChI | InChI=1S/C23H25N5/c1-14(2)16-5-3-15(4-6-16)13-28-12-11-18-20(28)10-9-19-21(18)22(24)27-23(26-19)25-17-7-8-17/h3-6,9-12,14,17H,7-8,13H2,1-2H3,(H3,24,25,26,27) |
| InChIKey | AVXQPEKZIGPIJW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. protease-activated receptor-1 antagonist An antagonist at the protease-activated receptor-1. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SCH-79797 (CHEBI:94998) has role antibacterial agent (CHEBI:33282) |
| SCH-79797 (CHEBI:94998) has role apoptosis inducer (CHEBI:68495) |
| SCH-79797 (CHEBI:94998) has role cardioprotective agent (CHEBI:77307) |
| SCH-79797 (CHEBI:94998) has role protease-activated receptor-1 antagonist (CHEBI:83313) |
| SCH-79797 (CHEBI:94998) is a cyclopropanes (CHEBI:51454) |
| SCH-79797 (CHEBI:94998) is a pyrroloquinazoline (CHEBI:231697) |
| SCH-79797 (CHEBI:94998) is a secondary amino compound (CHEBI:50995) |
| SCH-79797 (CHEBI:94998) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N3-cyclopropyl-7-[4-(propan-2-yl)benzyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| Synonyms | Source |
|---|---|
| SCH 79797 | ChEBI |
| SCH79797 | ChEBI |
| Citations |
|---|