EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O6 |
| Net Charge | 0 |
| Average Mass | 324.373 |
| Monoisotopic Mass | 324.15729 |
| SMILES | [H][C@@]12OC(=O)C(=C)[C@]1([H])CC[C@H](CO)[C@]1(O)CC[C@H](OC(C)=O)[C@@]21C |
| InChI | InChI=1S/C17H24O6/c1-9-12-5-4-11(8-18)17(21)7-6-13(22-10(2)19)16(17,3)14(12)23-15(9)20/h11-14,18,21H,1,4-8H2,2-3H3/t11-,12+,13+,14-,16+,17-/m1/s1 |
| InChIKey | CLPRBVIHHFLWQY-SGXNCSQFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetraneurin E (CHEBI:9499) has role metabolite (CHEBI:25212) |
| tetraneurin E (CHEBI:9499) is a acetate ester (CHEBI:47622) |
| tetraneurin E (CHEBI:9499) is a organic heterotricyclic compound (CHEBI:26979) |
| tetraneurin E (CHEBI:9499) is a sesquiterpene lactone (CHEBI:37667) |
| tetraneurin E (CHEBI:9499) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,6R,6aR,9S,9aS,9bR)-6a-hydroxy-6-(hydroxymethyl)-9a-methyl-3-methylidene-2-oxododecahydroazuleno[4,5-b]furan-9-yl acetate |
| Synonym | Source |
|---|---|
| Ambrosanolide | KEGG COMPOUND |
| Citations |
|---|