EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9495 - thiram
| Formula | C6H12N2S4 |
| Net Charge | 0 |
| Average Mass | 240.444 |
| Monoisotopic Mass | 239.98833 |
| SMILES | CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C6H12N2S4/c1-7(2)5(9)11-12-6(10)8(3)4/h1-4H3 |
| InChIKey | KUAZQDVKQLNFPE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiram (CHEBI:9495) has functional parent dimethyldithiocarbamic acid (CHEBI:83061) |
| thiram (CHEBI:9495) has part dimethyldithiocarbamate (CHEBI:84293) |
| thiram (CHEBI:9495) has role antibacterial drug (CHEBI:36047) |
| thiram (CHEBI:9495) has role antifungal agrochemical (CHEBI:86328) |
| thiram (CHEBI:9495) has role antiseptic drug (CHEBI:48218) |
| thiram (CHEBI:9495) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| [disulfanediylbis(carbonothioylnitrilo)]tetramethane |
| INNs | Source |
|---|---|
| thiram | ChemIDplus |
| thirame | ChemIDplus |
| thiramum | ChemIDplus |
| tiramo | WHO MedNet |
| Synonyms | Source |
|---|---|
| bis((dimethylamino)carbonothioyl) disulfide | ChemIDplus |
| Bis(dimethyl-thiocarbamoyl)-disulfid | ChemIDplus |
| bis(dimethyl thiocarbamoyl)disulfide | ChemIDplus |
| bis(dimethylthiocarbamoyl) disulfide | NIST Chemistry WebBook |
| disulfure de tetramethylthiourame | ChemIDplus |
| N,N'-(dithiodicarbonothioyl)bis(N-methylmethanamine) | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Arasan | ChEBI |
| Nomersan | ChEBI |
| Pomarsol | ChEBI |
| Rezifilm | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| tetramethylthiuram disulfide | UniProt |
| Citations |
|---|