EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9495 - thiram
| Formula | C6H12N2S4 |
| Net Charge | 0 |
| Average Mass | 240.444 |
| Monoisotopic Mass | 239.98833 |
| SMILES | CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C6H12N2S4/c1-7(2)5(9)11-12-6(10)8(3)4/h1-4H3 |
| InChIKey | KUAZQDVKQLNFPE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiram (CHEBI:9495) has functional parent dimethyldithiocarbamic acid (CHEBI:83061) |
| thiram (CHEBI:9495) has part dimethyldithiocarbamate (CHEBI:84293) |
| thiram (CHEBI:9495) has role antibacterial drug (CHEBI:36047) |
| thiram (CHEBI:9495) has role antifungal agrochemical (CHEBI:86328) |
| thiram (CHEBI:9495) has role antiseptic drug (CHEBI:48218) |
| thiram (CHEBI:9495) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| [disulfanediylbis(carbonothioylnitrilo)]tetramethane |
| INNs | Source |
|---|---|
| thiram | ChemIDplus |
| thirame | ChemIDplus |
| thiramum | ChemIDplus |
| tiramo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tetramethylthioperoxydicarbonic diamide | KEGG COMPOUND |
| Thiram | KEGG COMPOUND |
| disulfure de tetramethylthiourame | ChemIDplus |
| Tetramethyl-thiram disulfid | ChemIDplus |
| Bis(dimethyl-thiocarbamoyl)-disulfid | ChemIDplus |
| bis(dimethyl thiocarbamoyl)disulfide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Rezifilm | KEGG DRUG |
| Nomersan | ChEBI |
| Arasan | ChEBI |
| Pomarsol | ChEBI |
| UniProt Name | Source |
|---|---|
| tetramethylthiuram disulfide | UniProt |
| Citations |
|---|