EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5Cl2NS |
| Net Charge | 0 |
| Average Mass | 206.097 |
| Monoisotopic Mass | 204.95198 |
| SMILES | NC(=S)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl2NS/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChIKey | KGKGSIUWJCAFPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichlorothiobenzamide (CHEBI:949) has role agrochemical (CHEBI:33286) |
| 2,6-dichlorothiobenzamide (CHEBI:949) has role proherbicide (CHEBI:136646) |
| 2,6-dichlorothiobenzamide (CHEBI:949) is a dichlorobenzene (CHEBI:23697) |
| 2,6-dichlorothiobenzamide (CHEBI:949) is a thiocarboxamide (CHEBI:47956) |
| IUPAC Name |
|---|
| 2,6-dichlorobenzenecarbothioamide |
| Synonyms | Source |
|---|---|
| 2,6-dichlorobenzene-1-carbothioamide | Alan Wood's Pesticides |
| 2,6-Dichlorothiobenzamide | KEGG COMPOUND |
| 2,6-Dichlor-thiobenzamid | ChemIDplus |
| Chlorthiamid | KEGG COMPOUND |
| Chlorthiamid | ChemIDplus |
| Chlorthioamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 158 | PPDB |
| C11041 | KEGG COMPOUND |
| chlorthiamid | Alan Wood's Pesticides |
| Citations |
|---|