EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5Cl2NS |
| Net Charge | 0 |
| Average Mass | 206.097 |
| Monoisotopic Mass | 204.95198 |
| SMILES | NC(=S)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl2NS/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChIKey | KGKGSIUWJCAFPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichlorothiobenzamide (CHEBI:949) has role agrochemical (CHEBI:33286) |
| 2,6-dichlorothiobenzamide (CHEBI:949) has role proherbicide (CHEBI:136646) |
| 2,6-dichlorothiobenzamide (CHEBI:949) is a dichlorobenzene (CHEBI:23697) |
| 2,6-dichlorothiobenzamide (CHEBI:949) is a thiocarboxamide (CHEBI:47956) |
| IUPAC Name |
|---|
| 2,6-dichlorobenzenecarbothioamide |
| Synonyms | Source |
|---|---|
| Chlorthiamid | KEGG COMPOUND |
| 2,6-Dichlorothiobenzamide | KEGG COMPOUND |
| 2,6-dichlorobenzene-1-carbothioamide | Alan Wood's Pesticides |
| Chlortiamide | ChemIDplus |
| 2,6-Dichlor-thiobenzamid | ChemIDplus |
| WL-5792 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11041 | KEGG COMPOUND |
| chlorthiamid | Alan Wood's Pesticides |
| 158 | PPDB |
| Citations |
|---|