EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26NO3 |
| Net Charge | +1 |
| Average Mass | 304.410 |
| Monoisotopic Mass | 304.19072 |
| SMILES | C[N+]1(C)C2CC[C@H]1CC(OC(=O)C(CO)c1ccccc1)C2 |
| InChI | InChI=1S/C18H26NO3/c1-19(2)14-8-9-15(19)11-16(10-14)22-18(21)17(12-20)13-6-4-3-5-7-13/h3-7,14-17,20H,8-12H2,1-2H3/q+1/t14-,15?,16?,17?/m0/s1 |
| InChIKey | PIPAJLPNWZMYQA-HERJZLIOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-phenylpropanoic acid [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] ester (CHEBI:94847) is a tropane alkaloid (CHEBI:37332) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6065 | LINCS |