EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38F3N5O2 |
| Net Charge | 0 |
| Average Mass | 533.639 |
| Monoisotopic Mass | 533.29776 |
| SMILES | COC[C@@H](c1ccc(C(F)(F)F)cc1)N1CCN(C2(C)CCN(C(=O)c3c(C)ncnc3C)CC2)C[C@@H]1C |
| InChI | InChI=1S/C28H38F3N5O2/c1-19-16-35(14-15-36(19)24(17-38-5)22-6-8-23(9-7-22)28(29,30)31)27(4)10-12-34(13-11-27)26(37)25-20(2)32-18-33-21(25)3/h6-9,18-19,24H,10-17H2,1-5H3/t19-,24-/m0/s1 |
| InChIKey | CNPVJJQCETWNEU-CYFREDJKSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4,6-dimethyl-5-pyrimidinyl)-[4-[(3S)-4-[(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methyl-1-piperazinyl]-4-methyl-1-piperidinyl]methanone (CHEBI:94843) has role anti-HIV agent (CHEBI:64946) |
| (4,6-dimethyl-5-pyrimidinyl)-[4-[(3S)-4-[(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methyl-1-piperazinyl]-4-methyl-1-piperidinyl]methanone (CHEBI:94843) has role antineoplastic agent (CHEBI:35610) |
| (4,6-dimethyl-5-pyrimidinyl)-[4-[(3S)-4-[(1R)-2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methyl-1-piperazinyl]-4-methyl-1-piperidinyl]methanone (CHEBI:94843) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| vicriviroc | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-7690 | ChEMBL |
| SCH-417690 FREE BASE | ChEMBL |
| SCH-D | ChEMBL |
| vicriviroc | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-6059 | LINCS |
| Citations |
|---|