EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C11H17N |
| Net Charge | 0 |
| Average Mass | 326.528 |
| Monoisotopic Mass | 326.27220 |
| SMILES | CNC(C)(C)Cc1ccccc1.CNC(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/2C11H17N/c2*1-11(2,12-3)9-10-7-5-4-6-8-10/h2*4-8,12H,9H2,1-3H3 |
| InChIKey | NOVKIURGAXWREA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,2-dimethyl-1-phenylpropan-2-amine (CHEBI:94842) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6058 | LINCS |