EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C16H18N2O5S.C16H20N2 |
| Net Charge | 0 |
| Average Mass | 941.142 |
| Monoisotopic Mass | 940.34993 |
| SMILES | CC1(C)S[C@H]2[C@H](NC(=O)COc3ccccc3)C(=O)N2C1C(=O)O.CC1(C)S[C@H]2[C@H](NC(=O)COc3ccccc3)C(=O)N2C1C(=O)O.c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/2C16H18N2O5S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12?,14+;/m11./s1 |
| InChIKey | BBTOYUUSUQNIIY-BMPBAHJNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-6045 (CHEBI:94833) is a penicillin (CHEBI:17334) |
| Manual Xrefs | Databases |
|---|---|
| LSM-6045 | LINCS |