EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:94809 - N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide
| Formula | C20H26N2O4 |
| Net Charge | 0 |
| Average Mass | 358.438 |
| Monoisotopic Mass | 358.18926 |
| SMILES | COc1ccc(C(=O)NCc2ccc(OCCN(C)C)cc2)cc1OC |
| InChI | InChI=1S/C20H26N2O4/c1-22(2)11-12-26-17-8-5-15(6-9-17)14-21-20(23)16-7-10-18(24-3)19(13-16)25-4/h5-10,13H,11-12,14H2,1-4H3,(H,21,23) |
| InChIKey | QQQIECGTIMUVDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide (CHEBI:94809) has role antispasmodic drug (CHEBI:53784) |
| N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide (CHEBI:94809) has role gastrointestinal drug (CHEBI:55324) |
| N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide (CHEBI:94809) has role laxative (CHEBI:50503) |
| N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide (CHEBI:94809) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| itoprida | WHO MedNet |
| Synonyms | Source |
|---|---|
| ganaton | DrugCentral |
| itopride | ChEMBL |
| Itopride | ChEMBL |
| itopride HCl | DrugCentral |
| itopride hydrochloride | DrugCentral |
| itropride | DrugCentral |
| Citations |
|---|