EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:94807 - acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester
| Formula | C12H9N3O5S |
| Net Charge | 0 |
| Average Mass | 307.287 |
| Monoisotopic Mass | 307.02629 |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H9N3O5S/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19/h2-6H,1H3,(H,13,14,17) |
| InChIKey | YQNQNVDNTFHQSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antirheumatic drug A drug used to treat rheumatoid arthritis. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has functional parent salicylamide (CHEBI:32114) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role anti-HBV agent (CHEBI:64951) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role anti-HIV agent (CHEBI:64946) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antiamoebic agent (CHEBI:171664) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antibacterial agent (CHEBI:33282) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antidiarrhoeal drug (CHEBI:55323) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antirheumatic drug (CHEBI:35842) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antispasmodic drug (CHEBI:53784) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antitubercular agent (CHEBI:33231) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role antiviral agent (CHEBI:22587) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role hypoglycemic agent (CHEBI:35526) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) has role renoprotective agent (CHEBI:231911) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) is a benzamides (CHEBI:22702) |
| acetic acid [2-[[(5-nitro-2-thiazolyl)amino]-oxomethyl]phenyl] ester (CHEBI:94807) is a carboxylic ester (CHEBI:33308) |
| Synonyms | Source |
|---|---|
| nitazode | DrugCentral |
| nitazoxanida | DrugCentral |
| nitazoxanide | ChEMBL |
| Nitazoxanide | ChEMBL |
| nizonide | DrugCentral |
| NSC-697855 | ChEMBL |
| Brand Name | Source |
|---|---|
| Alinia | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1943 | DrugCentral |
| HMDB0014649 | HMDB |
| LSM-6002 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:55981-09-4 | DrugCentral |
| Citations |
|---|