EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11ClN4O |
| Net Charge | 0 |
| Average Mass | 322.755 |
| Monoisotopic Mass | 322.06214 |
| SMILES | O=C(Nc1cc(Cl)cc2c1nc1cnccc12)c1cccnc1 |
| InChI | InChI=1S/C17H11ClN4O/c18-11-6-13-12-3-5-20-9-15(12)21-16(13)14(7-11)22-17(23)10-2-1-4-19-8-10/h1-9,21H,(H,22,23) |
| InChIKey | JZRMBDHPALEPDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.10 (IkappaB kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of IκB kinase (EC 2.7.11.10). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS-1145 (CHEBI:94801) has role antineoplastic agent (CHEBI:35610) |
| PS-1145 (CHEBI:94801) has role apoptosis inducer (CHEBI:68495) |
| PS-1145 (CHEBI:94801) has role EC 2.7.11.10 (IκB kinase) inhibitor (CHEBI:77113) |
| PS-1145 (CHEBI:94801) is a organochlorine compound (CHEBI:36683) |
| PS-1145 (CHEBI:94801) is a pyridinecarboxamide (CHEBI:25529) |
| PS-1145 (CHEBI:94801) is a secondary carboxamide (CHEBI:140325) |
| PS-1145 (CHEBI:94801) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| N-(6-chloro-9H-β-carbolin-8-yl)pyridine-3-carboxamide |
| Synonyms | Source |
|---|---|
| N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)pyridine-3-carboxamide | IUPAC |
| N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-3-pyridinecarboxamide | ChEBI |
| PS1145 | ChEBI |
| PS 1145 | ChEBI |
| N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)nicotinamide | ChEBI |
| IKK inhibitor X | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-5975 | LINCS |
| HMDB0256885 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:431898-65-6 | ChEBI |
| Citations |
|---|