EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15FIN3O3 |
| Net Charge | 0 |
| Average Mass | 431.205 |
| Monoisotopic Mass | 431.01422 |
| SMILES | O=C(NC[C@H](O)CO)c1ccncc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H15FIN3O3/c16-12-5-9(17)1-2-13(12)20-14-7-18-4-3-11(14)15(23)19-6-10(22)8-21/h1-5,7,10,20-22H,6,8H2,(H,19,23)/t10-/m0/s1 |
| InChIKey | VIUAUNHCRHHYNE-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor An EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor that inhibits the action of mitogen-activated protein kinase kinase (EC 2.7.12.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimasertib (CHEBI:94793) has role antineoplastic agent (CHEBI:35610) |
| pimasertib (CHEBI:94793) has role apoptosis inducer (CHEBI:68495) |
| pimasertib (CHEBI:94793) has role EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor (CHEBI:88286) |
| pimasertib (CHEBI:94793) is a aminopyridine (CHEBI:38207) |
| pimasertib (CHEBI:94793) is a difluorobenzene (CHEBI:38582) |
| pimasertib (CHEBI:94793) is a diol (CHEBI:23824) |
| pimasertib (CHEBI:94793) is a primary alcohol (CHEBI:15734) |
| pimasertib (CHEBI:94793) is a pyridinecarboxamide (CHEBI:25529) |
| pimasertib (CHEBI:94793) is a secondary alcohol (CHEBI:35681) |
| pimasertib (CHEBI:94793) is a secondary carboxamide (CHEBI:140325) |
| pimasertib (CHEBI:94793) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-[(2S)-2,3-dihydroxypropyl]-3-(2-fluoro-4-iodoanilino)pyridine-4-carboxamide |
| INNs | Source |
|---|---|
| pimasertib | WHO MedNet |
| pimasertib | WHO MedNet |
| pimasertib | WHO MedNet |
| pimasertibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AS 703026 | ChEBI |
| AS-703026 | ChEBI |
| AS703026 | ChEBI |
| N-[(2S)-2,3-dihydroxypropyl]-3-(2-fluoro-4-iodoanilino)-4-pyridinecarboxamide | ChEBI |
| MSC-1236369B | ChEBI |
| MSC 1936369B | ChEBI |
| Citations |
|---|