EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:94789 - 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine
| Formula | C14H22N2O3 |
| Net Charge | 0 |
| Average Mass | 266.341 |
| Monoisotopic Mass | 266.16304 |
| SMILES | COc1ccc(CN2CCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3 |
| InChIKey | UHWVSEOVJBQKBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) has role antihypertensive agent (CHEBI:35674) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) has role cardiovascular drug (CHEBI:35554) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) has role hypoglycemic agent (CHEBI:35526) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) is a aromatic amine (CHEBI:33860) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) is a methoxybenzenes (CHEBI:51683) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| trimetazidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dilatan | ChEMBL |
| trimetazidine | ChEMBL |
| Trimetazidine | ChEMBL |
| trimetazidine dihydrochloride | DrugCentral |
| trimetazidine HCl | DrugCentral |
| trimetazidine hydrochloride | DrugCentral |
| Brand Name | Source |
|---|---|
| Vastarel mr | ChEMBL |
| Citations |
|---|