EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:94789 - 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine
| Formula | C14H22N2O3 |
| Net Charge | 0 |
| Average Mass | 266.341 |
| Monoisotopic Mass | 266.16304 |
| SMILES | COc1ccc(CN2CCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3 |
| InChIKey | UHWVSEOVJBQKBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) has role antihypertensive agent (CHEBI:35674) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) has role cardiovascular drug (CHEBI:35554) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) has role hypoglycemic agent (CHEBI:35526) |
| 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (CHEBI:94789) is a aromatic amine (CHEBI:33860) |
| INN | Source |
|---|---|
| trimetazidina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dilatan | ChEMBL |
| trimetazidine | ChEMBL |
| Trimetazidine | ChEMBL |
| trimetazidine dihydrochloride | DrugCentral |
| trimetazidine HCl | DrugCentral |
| trimetazidine hydrochloride | DrugCentral |
| Brand Name | Source |
|---|---|
| Vastarel mr | ChEMBL |
| Citations |
|---|