EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO3 |
| Net Charge | 0 |
| Average Mass | 279.380 |
| Monoisotopic Mass | 279.18344 |
| SMILES | CC(=O)Oc1cc(C(C)C)c(OCCN(C)C)cc1C |
| InChI | InChI=1S/C16H25NO3/c1-11(2)14-10-15(20-13(4)18)12(3)9-16(14)19-8-7-17(5)6/h9-11H,7-8H2,1-6H3 |
| InChIKey | VRYMTAVOXVTQEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetic acid [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] ester (CHEBI:94754) has role cardiovascular drug (CHEBI:35554) |
| acetic acid [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] ester (CHEBI:94754) has role vasodilator agent (CHEBI:35620) |
| acetic acid [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] ester (CHEBI:94754) is a monoterpenoid (CHEBI:25409) |
| INN | Source |
|---|---|
| moxisilita | WHO MedNet |
| Synonyms | Source |
|---|---|
| acetoxythymoxamine | DrugCentral |
| carlytene | DrugCentral |
| moxilite | DrugCentral |
| moxisylite | DrugCentral |
| moxisylyt | DrugCentral |
| moxisylyte | ChEMBL |
| Brand Names | Source |
|---|---|
| Erecnos | ChEMBL |
| Moxivig | ChEMBL |
| Citations |
|---|