EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO2S |
| Net Charge | 0 |
| Average Mass | 303.427 |
| Monoisotopic Mass | 303.12930 |
| SMILES | O=C(CCCCCCSc1ccc2ccccc2c1)NO |
| InChI | InChI=1S/C17H21NO2S/c19-17(18-20)9-3-1-2-6-12-21-16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,10-11,13,20H,1-3,6,9,12H2,(H,18,19) |
| InChIKey | KPNNXHVGOKRBEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role angiogenesis inhibitor (CHEBI:48422) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role antifibrotic agent (CHEBI:233423) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role antineoplastic agent (CHEBI:35610) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role apoptosis inducer (CHEBI:68495) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) is a aryl sulfide (CHEBI:35683) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) is a hydroxamic acid (CHEBI:24650) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) is a naphthalenes (CHEBI:25477) |
| IUPAC Name |
|---|
| N-hydroxy-7-(naphthalen-2-ylsulfanyl)heptanamide |
| Synonyms | Source |
|---|---|
| HNHA | ChEBI |
| histone deacetylase inhibitor VI | ChEBI |
| N-hydroxy-7-(2-naphthalenylthio)-heptanamide | ChEBI |
| N-hydroxy-7-naphthalen-2-ylsulfanylheptanamide | ChEBI |
| N-hydroxy-7-(2-naphthylthio)heptanomide | ChEBI |
| N-hydroxy-7-(2-naphthalenylthio)heptanamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-5837 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:926908-04-5 | ChEBI |
| Citations |
|---|