EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO2S |
| Net Charge | 0 |
| Average Mass | 303.427 |
| Monoisotopic Mass | 303.12930 |
| SMILES | O=C(CCCCCCSc1ccc2ccccc2c1)NO |
| InChI | InChI=1S/C17H21NO2S/c19-17(18-20)9-3-1-2-6-12-21-16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,10-11,13,20H,1-3,6,9,12H2,(H,18,19) |
| InChIKey | KPNNXHVGOKRBEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role angiogenesis inhibitor (CHEBI:48422) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role antifibrotic agent (CHEBI:233423) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role antineoplastic agent (CHEBI:35610) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role apoptosis inducer (CHEBI:68495) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) is a aryl sulfide (CHEBI:35683) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) is a hydroxamic acid (CHEBI:24650) |
| N-hydroxy-7-(naphthalen-2-ylthio)heptanamide (CHEBI:94741) is a naphthalenes (CHEBI:25477) |
| IUPAC Name |
|---|
| N-hydroxy-7-(naphthalen-2-ylsulfanyl)heptanamide |
| Synonyms | Source |
|---|---|
| N-hydroxy-7-(2-naphthalenylthio)-heptanamide | ChEBI |
| N-hydroxy-7-(2-naphthalenylthio)heptanamide | ChEBI |
| N-hydroxy-7-(2-naphthylthio)heptanamide | ChEBI |
| N-hydroxy-7-(2-naphthylthio)heptanomide | ChEBI |
| N-hydroxy-7-naphthalen-2-ylsulfanylheptanamide | ChEBI |
| histone deacetylase inhibitor VI | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-5837 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:926908-04-5 | ChEBI |
| Citations |
|---|