EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7F3O4 |
| Net Charge | 0 |
| Average Mass | 248.156 |
| Monoisotopic Mass | 248.02964 |
| SMILES | CC(=O)Oc1cc(C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C10H7F3O4/c1-5(14)17-8-4-6(10(11,12)13)2-3-7(8)9(15)16/h2-4H,1H3,(H,15,16) |
| InChIKey | RMWVZGDJPAKBDE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| Applications: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acetyloxy-4-(trifluoromethyl)benzoic acid (CHEBI:94721) has role anticoagulant (CHEBI:50249) |
| 2-acetyloxy-4-(trifluoromethyl)benzoic acid (CHEBI:94721) has role insulin-sensitizing drug (CHEBI:50864) |
| 2-acetyloxy-4-(trifluoromethyl)benzoic acid (CHEBI:94721) is a benzoic acids (CHEBI:22723) |
| 2-acetyloxy-4-(trifluoromethyl)benzoic acid (CHEBI:94721) is a carboxylic ester (CHEBI:33308) |
| 2-acetyloxy-4-(trifluoromethyl)benzoic acid (CHEBI:94721) is a organic molecular entity (CHEBI:50860) |
| 2-acetyloxy-4-(trifluoromethyl)benzoic acid (CHEBI:94721) is a salicylates (CHEBI:26596) |
| Synonyms | Source |
|---|---|
| disgren | DrugCentral |
| triflusal | ChEMBL |
| Triflusal | ChEMBL |
| Citations |
|---|