EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN6OS2 |
| Net Charge | 0 |
| Average Mass | 430.946 |
| Monoisotopic Mass | 430.04373 |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ncc(CCNc2ncnc3ccsc23)s1 |
| InChI | InChI=1S/C18H15ClN6OS2/c19-11-2-1-3-12(8-11)24-17(26)25-18-21-9-13(28-18)4-6-20-16-15-14(5-7-27-15)22-10-23-16/h1-3,5,7-10H,4,6H2,(H,20,22,23)(H2,21,24,25,26) |
| InChIKey | FAYAUAZLLLJJGH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3-chlorophenyl)-3-[5-[2-(4-thieno[3,2-d]pyrimidinylamino)ethyl]-2-thiazolyl]urea (CHEBI:94720) has role antineoplastic agent (CHEBI:35610) |
| 1-(3-chlorophenyl)-3-[5-[2-(4-thieno[3,2-d]pyrimidinylamino)ethyl]-2-thiazolyl]urea (CHEBI:94720) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| sns-314 | ChEMBL |
| Sns 314 | ChEMBL |
| Sns-314 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-5795 | LINCS |
| Citations |
|---|