EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12O8 |
| Net Charge | 0 |
| Average Mass | 368.297 |
| Monoisotopic Mass | 368.05322 |
| SMILES | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)O)cc1C2=O |
| InChI | InChI=1S/C19H12O8/c1-8(20)26-13-5-3-4-11-15(13)18(23)16-12(17(11)22)6-10(19(24)25)7-14(16)27-9(2)21/h3-7H,1-2H3,(H,24,25) |
| InChIKey | TYNLGDBUJLVSMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-inflammatory agent Any compound that has anti-inflammatory effects. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid (CHEBI:94708) has role anti-inflammatory agent (CHEBI:67079) |
| 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid (CHEBI:94708) has role antirheumatic drug (CHEBI:35842) |
| 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid (CHEBI:94708) has role antiviral agent (CHEBI:22587) |
| 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid (CHEBI:94708) has role gout suppressant (CHEBI:35845) |
| 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid (CHEBI:94708) has role hypoglycemic agent (CHEBI:35526) |
| 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid (CHEBI:94708) is a anthraquinone (CHEBI:22580) |
| INNs | Source |
|---|---|
| diacereina | WHO MedNet |
| diacereine | WHO MedNet |
| Synonyms | Source |
|---|---|
| AC-201 | ChEMBL |
| Ac-203 | ChEMBL |
| artrodar | DrugCentral |
| diacerein | ChEMBL |
| Diacerein | ChEMBL |
| diacerhein | DrugCentral |
| Citations |
|---|