EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H33ClN4O2 |
| Net Charge | 0 |
| Average Mass | 517.073 |
| Monoisotopic Mass | 516.22920 |
| SMILES | Cc1ccc(C(=O)N(CCCN)[C@@H](c2nc3cc(Cl)ccc3c(=O)n2Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C30H33ClN4O2/c1-20(2)27(34(17-7-16-32)29(36)23-12-10-21(3)11-13-23)28-33-26-18-24(31)14-15-25(26)30(37)35(28)19-22-8-5-4-6-9-22/h4-6,8-15,18,20,27H,7,16-17,19,32H2,1-3H3/t27-/m1/s1 |
| InChIKey | QJZRFPJCWMNVAV-HHHXNRCGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-aminopropyl)-N-[(1R)-1-[7-chloro-4-oxo-3-(phenylmethyl)-2-quinazolinyl]-2-methylpropyl]-4-methylbenzamide (CHEBI:94692) has role antineoplastic agent (CHEBI:35610) |
| N-(3-aminopropyl)-N-[(1R)-1-[7-chloro-4-oxo-3-(phenylmethyl)-2-quinazolinyl]-2-methylpropyl]-4-methylbenzamide (CHEBI:94692) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| ispinesib | WHO MedNet |
| Synonym | Source |
|---|---|
| ispinesib | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-5732 | LINCS |
| Citations |
|---|