EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N6O2 |
| Net Charge | 0 |
| Average Mass | 346.350 |
| Monoisotopic Mass | 346.11782 |
| SMILES | Nc1nc(N)c2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc2n1 |
| InChI | InChI=1S/C18H14N6O2/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9/h1-8,25-26H,(H4,19,20,22,23,24) |
| InChIKey | UJIAQDJKSXQLIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[2,4-diamino-7-(3-hydroxyphenyl)-6-pteridinyl]phenol (CHEBI:94691) has role cardiovascular drug (CHEBI:35554) |
| 3-[2,4-diamino-7-(3-hydroxyphenyl)-6-pteridinyl]phenol (CHEBI:94691) is a pteridines (CHEBI:26373) |
| Synonyms | Source |
|---|---|
| tg100-115 | ChEMBL |
| Tg100-115 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-5731 | LINCS |
| Citations |
|---|