EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O3S |
| Net Charge | 0 |
| Average Mass | 244.316 |
| Monoisotopic Mass | 244.08816 |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@H]2NC(=O)N[C@H]12 |
| InChI | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7+,9+/m1/s1 |
| InChIKey | YBJHBAHKTGYVGT-FJXKBIBVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(3aS,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid (CHEBI:94689) is a biotins (CHEBI:51570) |
| Manual Xrefs | Databases |
|---|---|
| LSM-5727 | LINCS |