EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N2O3 |
| Net Charge | 0 |
| Average Mass | 154.125 |
| Monoisotopic Mass | 154.03784 |
| SMILES | Cc1cnc(C(=O)O)c[n+]1[O-] |
| InChI | InChI=1S/C6H6N2O3/c1-4-2-7-5(6(9)10)3-8(4)11/h2-3H,1H3,(H,9,10) |
| InChIKey | DJQOOSBJCLSSEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-4-oxido-2-pyrazin-4-iumcarboxylic acid (CHEBI:94688) has role cardiovascular drug (CHEBI:35554) |
| 5-methyl-4-oxido-2-pyrazin-4-iumcarboxylic acid (CHEBI:94688) has role hypoglycemic agent (CHEBI:35526) |
| 5-methyl-4-oxido-2-pyrazin-4-iumcarboxylic acid (CHEBI:94688) is a pyrazinecarboxylic acid (CHEBI:48345) |
| Synonyms | Source |
|---|---|
| acipimox | ChEMBL |
| Acipimox | ChEMBL |
| methylpyrazinecarboxylic acid 4-oxide | DrugCentral |
| NSC-759818 | ChEMBL |
| olbemox | DrugCentral |
| olbetam | DrugCentral |
| Citations |
|---|