EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H53NO5 |
| Net Charge | 0 |
| Average Mass | 495.745 |
| Monoisotopic Mass | 495.39237 |
| SMILES | [H]C(=O)N[C@@H](CC(C)C)C(=O)O[C@@H](CCCCCCCCCCC)C[C@]1([H])OC(=O)[C@@]1([H])CCCCCC |
| InChI | InChI=1S/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27-/m0/s1 |
| InChIKey | AHLBNYSZXLDEJQ-FWEHEUNISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces toxytricini (ncbitaxon:67369) | - | Article (EP129748) | Isolated from fermentation broth |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). anti-obesity agent Any substance which is used to reduce or control weight. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orlistat (CHEBI:94686) has role anti-obesity agent (CHEBI:74518) |
| orlistat (CHEBI:94686) has role bacterial metabolite (CHEBI:76969) |
| orlistat (CHEBI:94686) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| orlistat (CHEBI:94686) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| orlistat (CHEBI:94686) is a L-leucine derivative (CHEBI:25018) |
| orlistat (CHEBI:94686) is a carboxylic ester (CHEBI:33308) |
| orlistat (CHEBI:94686) is a formamides (CHEBI:24079) |
| orlistat (CHEBI:94686) is a β-lactone (CHEBI:49043) |
| IUPAC Name |
|---|
| (2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridecan-2-yl N-formyl-L-leucinate |
| INNs | Source |
|---|---|
| orlistat | ChEBI |
| orlistat | ChEBI |
| orlistat | ChEBI |
| orlistatum | ChEBI |
| Synonyms | Source |
|---|---|
| (2S)-2-formamido-4-methylpentanoic acid [(2S)-1-[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]tridecan-2-yl] ester | ChEBI |
| N-formyl-L-leucine (1S)-1-{[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl}dodecyl ester | ChEBI |
| orlipastat | ChEBI |
| Ro-18-0647 | ChEBI |
| (−)-tetrahydrolipostatin | ChEBI |
| Brand Names | Source |
|---|---|
| Alli | ChemIDplus |
| Xenical | ChemIDplus |
| Citations |
|---|